C13H20N2O7 — CID 54285390
3-amino-4-[(1-cyclopentyloxy-3-methoxy-1,3-dioxopropan-2-yl)amino]-4-oxobutanoic acid (PubChem CID 54285390) has the molecular formula C13H20N2O7 and a molecular weight of 316.31 g/mol. Its IUPAC name is 3-amino-4-[(1-cyclopentyloxy-3-methoxy-1,3-dioxopropan-2-yl)amino]-4-oxobutanoic acid.
| Compound Name | 3-amino-4-[(1-cyclopentyloxy-3-methoxy-1,3-dioxopropan-2-yl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54285390 |
| Molecular Formula | C13H20N2O7 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 3-amino-4-[(1-cyclopentyloxy-3-methoxy-1,3-dioxopropan-2-yl)amino]-4-oxobutanoic acid |
| SMILES | COC(=O)C(NC(=O)C(N)CC(=O)O)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C13H20N2O7/c1-21-12(19)10(13(20)22-7-4-2-3-5-7)15-11(18)8(14)6-9(16)17/h7-8,10H,2-6,14H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | RTSGCIPLUNJINX-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 145.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|