C24H28FNO5 — CID 155275784
3-[4-[[5-fluoro-2-[2-(1-hydroxyethylamino)ethyl]-1-benzofuran-7-yl]methoxy]-2,3-dimethylphenyl]propanoic acid (PubChem CID 155275784) has the molecular formula C24H28FNO5 and a molecular weight of 429.49 g/mol. Its IUPAC name is 3-[4-[[5-fluoro-2-[2-(1-hydroxyethylamino)ethyl]-1-benzofuran-7-yl]methoxy]-2,3-dimethylphenyl]propanoic acid.
| Compound Name | 3-[4-[[5-fluoro-2-[2-(1-hydroxyethylamino)ethyl]-1-benzofuran-7-yl]methoxy]-2,3-dimethylphenyl]propanoic acid |
|---|---|
| PubChem CID | 155275784 |
| Molecular Formula | C24H28FNO5 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | 3-[4-[[5-fluoro-2-[2-(1-hydroxyethylamino)ethyl]-1-benzofuran-7-yl]methoxy]-2,3-dimethylphenyl]propanoic acid |
| SMILES | Cc1c(CCC(=O)O)ccc(OCc2cc(F)cc3cc(CCNC(C)O)oc23)c1C |
| InChI | InChI=1S/C24H28FNO5/c1-14-15(2)22(6-4-17(14)5-7-23(28)29)30-13-19-11-20(25)10-18-12-21(31-24(18)19)8-9-26-16(3)27/h4,6,10-12,16,26-27H,5,7-9,13H2,1-3H3,(H,28,29) |
| InChIKey | FJCQIZGUFUDFKX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|