C34H32N4O12S2 — CID 155278181
N-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]-2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxamide;ethane-1,1-disulfonic acid (PubChem CID 155278181) has the molecular formula C34H32N4O12S2 and a molecular weight of 752.78 g/mol. Its IUPAC name is N-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]-2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxamide;ethane-1,1-disulfonic acid.
| Compound Name | N-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]-2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxamide;ethane-1,1-disulfonic acid |
|---|---|
| PubChem CID | 155278181 |
| Molecular Formula | C34H32N4O12S2 |
| Molecular Weight | 752.78 g/mol |
| Exact Mass | 752.15 |
| IUPAC Name | N-[5-(6,7-dimethoxyquinolin-4-yl)oxy-2-pyridinyl]-2,5-dioxo-1-phenyl-7,8-dihydro-6H-quinoline-3-carboxamide;ethane-1,1-disulfonic acid |
| SMILES | CC(S(=O)(=O)O)S(=O)(=O)O.COc1cc2nccc(Oc3ccc(NC(=O)c4cc5c(n(-c6ccccc6)c4=O)CCCC5=O)nc3)c2cc1OC |
| InChI | InChI=1S/C32H26N4O6.C2H6O6S2/c1-40-28-16-21-24(17-29(28)41-2)33-14-13-27(21)42-20-11-12-30(34-18-20)35-31(38)23-15-22-25(9-6-10-26(22)37)36(32(23)39)19-7-4-3-5-8-19;1-2(9(3,4)5)10(6,7)8/h3-5,7-8,11-18H,6,9-10H2,1-2H3,(H,34,35,38);2H,1H3,(H,3,4,5)(H,6,7,8) |
| InChIKey | JPUCFSGLIINUME-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 230.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.78 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|