C13H13F2N3O2S — CID 155278636
2-fluoro-N-(6-fluoro-2-pyridinyl)-5-methyl-4-(methylamino)benzenesulfonamide (PubChem CID 155278636) has the molecular formula C13H13F2N3O2S and a molecular weight of 313.33 g/mol. Its IUPAC name is 2-fluoro-N-(6-fluoro-2-pyridinyl)-5-methyl-4-(methylamino)benzenesulfonamide.
| Compound Name | 2-fluoro-N-(6-fluoro-2-pyridinyl)-5-methyl-4-(methylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 155278636 |
| Molecular Formula | C13H13F2N3O2S |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.07 |
| IUPAC Name | 2-fluoro-N-(6-fluoro-2-pyridinyl)-5-methyl-4-(methylamino)benzenesulfonamide |
| SMILES | CNc1cc(F)c(S(=O)(=O)Nc2cccc(F)n2)cc1C |
| InChI | InChI=1S/C13H13F2N3O2S/c1-8-6-11(9(14)7-10(8)16-2)21(19,20)18-13-5-3-4-12(15)17-13/h3-7,16H,1-2H3,(H,17,18) |
| InChIKey | LVSHONDJZZWIBS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|