C24H27N3O6 — CID 155281092
ethyl 2-[[(1,3-dioxoisoindol-2-yl)-(4-phenylmethoxybutyl)carbamoyl]amino]acetate (PubChem CID 155281092) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is ethyl 2-[[(1,3-dioxoisoindol-2-yl)-(4-phenylmethoxybutyl)carbamoyl]amino]acetate.
| Compound Name | ethyl 2-[[(1,3-dioxoisoindol-2-yl)-(4-phenylmethoxybutyl)carbamoyl]amino]acetate |
|---|---|
| PubChem CID | 155281092 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | ethyl 2-[[(1,3-dioxoisoindol-2-yl)-(4-phenylmethoxybutyl)carbamoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)N(CCCCOCc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C24H27N3O6/c1-2-33-21(28)16-25-24(31)26(14-8-9-15-32-17-18-10-4-3-5-11-18)27-22(29)19-12-6-7-13-20(19)23(27)30/h3-7,10-13H,2,8-9,14-17H2,1H3,(H,25,31) |
| InChIKey | AIXDXEKIGSCFJB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|