C9H20N4O3 — CID 155282670
2-amino-N-(2-hydrazinyl-2-oxoethyl)-3-[(2-methylpropan-2-yl)oxy]propanamide (PubChem CID 155282670) has the molecular formula C9H20N4O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-amino-N-(2-hydrazinyl-2-oxoethyl)-3-[(2-methylpropan-2-yl)oxy]propanamide.
| Compound Name | 2-amino-N-(2-hydrazinyl-2-oxoethyl)-3-[(2-methylpropan-2-yl)oxy]propanamide |
|---|---|
| PubChem CID | 155282670 |
| Molecular Formula | C9H20N4O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 2-amino-N-(2-hydrazinyl-2-oxoethyl)-3-[(2-methylpropan-2-yl)oxy]propanamide |
| SMILES | CC(C)(C)OCC(N)C(=O)NCC(=O)NN |
| InChI | InChI=1S/C9H20N4O3/c1-9(2,3)16-5-6(10)8(15)12-4-7(14)13-11/h6H,4-5,10-11H2,1-3H3,(H,12,15)(H,13,14) |
| InChIKey | KJEDRJXKHNCMGB-UHFFFAOYSA-N |
| XLogP | -1.77 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|