C8H18ClNO3 — CID 160898573
(2S)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoic acid;chloromethane (PubChem CID 160898573) has the molecular formula C8H18ClNO3 and a molecular weight of 211.69 g/mol. Its IUPAC name is (2S)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoic acid;chloromethane.
| Compound Name | (2S)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoic acid;chloromethane |
|---|---|
| PubChem CID | 160898573 |
| Molecular Formula | C8H18ClNO3 |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | (2S)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoic acid;chloromethane |
| SMILES | CC(C)(C)OC[C@H](N)C(=O)O.CCl |
| InChI | InChI=1S/C7H15NO3.CH3Cl/c1-7(2,3)11-4-5(8)6(9)10;1-2/h5H,4,8H2,1-3H3,(H,9,10);1H3/t5-;/m0./s1 |
| InChIKey | SPEWUSJWHPIHRX-JEDNCBNOSA-N |
| XLogP | 1.07 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|