C17H25NO5 — CID 155283257
ethyl 3-[3-hydroxy-4-(methoxymethoxy)-3,4-dimethylpyrrolidin-1-yl]benzoate (PubChem CID 155283257) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is ethyl 3-[3-hydroxy-4-(methoxymethoxy)-3,4-dimethylpyrrolidin-1-yl]benzoate.
| Compound Name | ethyl 3-[3-hydroxy-4-(methoxymethoxy)-3,4-dimethylpyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 155283257 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | ethyl 3-[3-hydroxy-4-(methoxymethoxy)-3,4-dimethylpyrrolidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(N2CC(C)(O)C(C)(OCOC)C2)c1 |
| InChI | InChI=1S/C17H25NO5/c1-5-22-15(19)13-7-6-8-14(9-13)18-10-16(2,20)17(3,11-18)23-12-21-4/h6-9,20H,5,10-12H2,1-4H3 |
| InChIKey | NIXRRXOOIIDNNE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|