C13H24O3 — CID 155284060
(2S)-2-(diethoxymethyl)-5,5-dimethylcyclohexan-1-one (PubChem CID 155284060) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is (2S)-2-(diethoxymethyl)-5,5-dimethylcyclohexan-1-one.
| Compound Name | (2S)-2-(diethoxymethyl)-5,5-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 155284060 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | (2S)-2-(diethoxymethyl)-5,5-dimethylcyclohexan-1-one |
| SMILES | CCOC(OCC)[C@@H]1CCC(C)(C)CC1=O |
| InChI | InChI=1S/C13H24O3/c1-5-15-12(16-6-2)10-7-8-13(3,4)9-11(10)14/h10,12H,5-9H2,1-4H3/t10-/m1/s1 |
| InChIKey | SQQBMROHOYUNEU-SNVBAGLBSA-N |
| XLogP | 2.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|