C9H9ClF3N3O — CID 155284780
3-[(6-chloropyridazin-3-yl)amino]-1-(trifluoromethyl)cyclobutan-1-ol (PubChem CID 155284780) has the molecular formula C9H9ClF3N3O and a molecular weight of 267.64 g/mol. Its IUPAC name is 3-[(6-chloropyridazin-3-yl)amino]-1-(trifluoromethyl)cyclobutan-1-ol.
| Compound Name | 3-[(6-chloropyridazin-3-yl)amino]-1-(trifluoromethyl)cyclobutan-1-ol |
|---|---|
| PubChem CID | 155284780 |
| Molecular Formula | C9H9ClF3N3O |
| Molecular Weight | 267.64 g/mol |
| Exact Mass | 267.04 |
| IUPAC Name | 3-[(6-chloropyridazin-3-yl)amino]-1-(trifluoromethyl)cyclobutan-1-ol |
| SMILES | OC1(C(F)(F)F)CC(Nc2ccc(Cl)nn2)C1 |
| InChI | InChI=1S/C9H9ClF3N3O/c10-6-1-2-7(16-15-6)14-5-3-8(17,4-5)9(11,12)13/h1-2,5,17H,3-4H2,(H,14,16) |
| InChIKey | ZZIWDJCCLMEQFZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.64 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |