C8H10ClN3O2 — CID 130729685
(3S,4R)-4-[(6-chloropyridazin-3-yl)amino]oxolan-3-ol (PubChem CID 130729685) has the molecular formula C8H10ClN3O2 and a molecular weight of 215.64 g/mol. Its IUPAC name is (3S,4R)-4-[(6-chloropyridazin-3-yl)amino]oxolan-3-ol.
| Compound Name | (3S,4R)-4-[(6-chloropyridazin-3-yl)amino]oxolan-3-ol |
|---|---|
| PubChem CID | 130729685 |
| Molecular Formula | C8H10ClN3O2 |
| Molecular Weight | 215.64 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | (3S,4R)-4-[(6-chloropyridazin-3-yl)amino]oxolan-3-ol |
| SMILES | O[C@@H]1COC[C@H]1Nc1ccc(Cl)nn1 |
| InChI | InChI=1S/C8H10ClN3O2/c9-7-1-2-8(12-11-7)10-5-3-14-4-6(5)13/h1-2,5-6,13H,3-4H2,(H,10,12)/t5-,6-/m1/s1 |
| InChIKey | KDODXIPGVCHIKX-PHDIDXHHSA-N |
| XLogP | 0.30 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.64 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |