C8H10FN3O2 — CID 130751611
(3S,4R)-4-[(6-fluoropyrimidin-4-yl)amino]oxolan-3-ol (PubChem CID 130751611) has the molecular formula C8H10FN3O2 and a molecular weight of 199.18 g/mol. Its IUPAC name is (3S,4R)-4-[(6-fluoropyrimidin-4-yl)amino]oxolan-3-ol.
| Compound Name | (3S,4R)-4-[(6-fluoropyrimidin-4-yl)amino]oxolan-3-ol |
|---|---|
| PubChem CID | 130751611 |
| Molecular Formula | C8H10FN3O2 |
| Molecular Weight | 199.18 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (3S,4R)-4-[(6-fluoropyrimidin-4-yl)amino]oxolan-3-ol |
| SMILES | O[C@@H]1COC[C@H]1Nc1cc(F)ncn1 |
| InChI | InChI=1S/C8H10FN3O2/c9-7-1-8(11-4-10-7)12-5-2-14-3-6(5)13/h1,4-6,13H,2-3H2,(H,10,11,12)/t5-,6-/m1/s1 |
| InChIKey | JLFVKXJWTBWMFY-PHDIDXHHSA-N |
| XLogP | -0.21 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.18 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |