C17H30N4O6 — CID 155284903
bis[2-[2-(dimethylamino)ethylamino]-2-oxoethyl] (E)-2-methylbut-2-enedioate (PubChem CID 155284903) has the molecular formula C17H30N4O6 and a molecular weight of 386.45 g/mol. Its IUPAC name is bis[2-[2-(dimethylamino)ethylamino]-2-oxoethyl] (E)-2-methylbut-2-enedioate.
| Compound Name | bis[2-[2-(dimethylamino)ethylamino]-2-oxoethyl] (E)-2-methylbut-2-enedioate |
|---|---|
| PubChem CID | 155284903 |
| Molecular Formula | C17H30N4O6 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | bis[2-[2-(dimethylamino)ethylamino]-2-oxoethyl] (E)-2-methylbut-2-enedioate |
| SMILES | C/C(=C\C(=O)OCC(=O)NCCN(C)C)C(=O)OCC(=O)NCCN(C)C |
| InChI | InChI=1S/C17H30N4O6/c1-13(17(25)27-12-15(23)19-7-9-21(4)5)10-16(24)26-11-14(22)18-6-8-20(2)3/h10H,6-9,11-12H2,1-5H3,(H,18,22)(H,19,23)/b13-10+ |
| InChIKey | MZEXLKCRFXWXCF-JLHYYAGUSA-N |
| XLogP | -1.63 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|