C20H21BrN4OS — CID 155287783
5-bromo-N-[4-(4-ethylpiperazin-1-yl)phenyl]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 155287783) has the molecular formula C20H21BrN4OS and a molecular weight of 445.39 g/mol. Its IUPAC name is 5-bromo-N-[4-(4-ethylpiperazin-1-yl)phenyl]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 5-bromo-N-[4-(4-ethylpiperazin-1-yl)phenyl]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155287783 |
| Molecular Formula | C20H21BrN4OS |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 5-bromo-N-[4-(4-ethylpiperazin-1-yl)phenyl]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3cc4cc(Br)cnc4s3)cc2)CC1 |
| InChI | InChI=1S/C20H21BrN4OS/c1-2-24-7-9-25(10-8-24)17-5-3-16(4-6-17)23-19(26)18-12-14-11-15(21)13-22-20(14)27-18/h3-6,11-13H,2,7-10H2,1H3,(H,23,26) |
| InChIKey | ZQVWOWHNUIYBLL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|