C30H35N5O3 — CID 155288197
3-tert-butyl-N-[(5R)-2-[2-[[(2R)-spiro[2.3]hexane-2-carbonyl]amino]-4-pyridinyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 155288197) has the molecular formula C30H35N5O3 and a molecular weight of 513.64 g/mol. Its IUPAC name is 3-tert-butyl-N-[(5R)-2-[2-[[(2R)-spiro[2.3]hexane-2-carbonyl]amino]-4-pyridinyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-tert-butyl-N-[(5R)-2-[2-[[(2R)-spiro[2.3]hexane-2-carbonyl]amino]-4-pyridinyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 155288197 |
| Molecular Formula | C30H35N5O3 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | 3-tert-butyl-N-[(5R)-2-[2-[[(2R)-spiro[2.3]hexane-2-carbonyl]amino]-4-pyridinyl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CC(C)(C)c1noc(C(=O)N[C@@H]2CCCCc3cc(-c4ccnc(NC(=O)[C@@H]5CC56CCC6)c4)ccc32)n1 |
| InChI | InChI=1S/C30H35N5O3/c1-29(2,3)28-34-27(38-35-28)26(37)32-23-8-5-4-7-20-15-18(9-10-21(20)23)19-11-14-31-24(16-19)33-25(36)22-17-30(22)12-6-13-30/h9-11,14-16,22-23H,4-8,12-13,17H2,1-3H3,(H,32,37)(H,31,33,36)/t22-,23+/m0/s1 |
| InChIKey | QLTFBZZPPOTQTE-XZOQPEGZSA-N |
| XLogP | 5.76 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |