C30H35N8O2+ — CID 166047921
3-tert-butyl-N-[2-[2-(2-ethyl-3-methyl-1H-pyrazol-2-ium-4-yl)-1H-imidazo[4,5-b]pyridin-7-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 166047921) has the molecular formula C30H35N8O2+ and a molecular weight of 539.66 g/mol. Its IUPAC name is 3-tert-butyl-N-[2-[2-(2-ethyl-3-methyl-1H-pyrazol-2-ium-4-yl)-1H-imidazo[4,5-b]pyridin-7-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-tert-butyl-N-[2-[2-(2-ethyl-3-methyl-1H-pyrazol-2-ium-4-yl)-1H-imidazo[4,5-b]pyridin-7-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 166047921 |
| Molecular Formula | C30H35N8O2+ |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.29 |
| IUPAC Name | 3-tert-butyl-N-[2-[2-(2-ethyl-3-methyl-1H-pyrazol-2-ium-4-yl)-1H-imidazo[4,5-b]pyridin-7-yl]-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CC[n+]1[nH]cc(-c2nc3nccc(-c4ccc5c(c4)CCCCC5NC(=O)c4nc(C(C)(C)C)no4)c3[nH]2)c1C |
| InChI | InChI=1S/C30H34N8O2/c1-6-38-17(2)22(16-32-38)25-34-24-21(13-14-31-26(24)35-25)19-11-12-20-18(15-19)9-7-8-10-23(20)33-27(39)28-36-29(37-40-28)30(3,4)5/h11-16,23H,6-10H2,1-5H3,(H2,31,33,34,35,39)/p+1 |
| InChIKey | PWJYNLOKRCDKQN-UHFFFAOYSA-O |
| XLogP | 5.11 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|