C20H22N6O5 — CID 155290637
6-(5-methylfuran-2-yl)-5-nitro-4-N-[[6-[[(3R)-oxolan-3-yl]oxymethyl]-2-pyridinyl]methyl]pyrimidine-2,4-diamine (PubChem CID 155290637) has the molecular formula C20H22N6O5 and a molecular weight of 426.43 g/mol. Its IUPAC name is 6-(5-methylfuran-2-yl)-5-nitro-4-N-[[6-[[(3R)-oxolan-3-yl]oxymethyl]-2-pyridinyl]methyl]pyrimidine-2,4-diamine.
| Compound Name | 6-(5-methylfuran-2-yl)-5-nitro-4-N-[[6-[[(3R)-oxolan-3-yl]oxymethyl]-2-pyridinyl]methyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 155290637 |
| Molecular Formula | C20H22N6O5 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 6-(5-methylfuran-2-yl)-5-nitro-4-N-[[6-[[(3R)-oxolan-3-yl]oxymethyl]-2-pyridinyl]methyl]pyrimidine-2,4-diamine |
| SMILES | Cc1ccc(-c2nc(N)nc(NCc3cccc(CO[C@@H]4CCOC4)n3)c2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C20H22N6O5/c1-12-5-6-16(31-12)17-18(26(27)28)19(25-20(21)24-17)22-9-13-3-2-4-14(23-13)10-30-15-7-8-29-11-15/h2-6,15H,7-11H2,1H3,(H3,21,22,24,25)/t15-/m1/s1 |
| InChIKey | ZRDKLABJNYITIT-OAHLLOKOSA-N |
| XLogP | 2.85 |
| TPSA | 151.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|