C16H17ClN6O — CID 146475044
4-N-[[6-(chloromethyl)-2-pyridinyl]methyl]-6-(5-methylfuran-2-yl)pyrimidine-2,4,5-triamine (PubChem CID 146475044) has the molecular formula C16H17ClN6O and a molecular weight of 344.81 g/mol. Its IUPAC name is 4-N-[[6-(chloromethyl)-2-pyridinyl]methyl]-6-(5-methylfuran-2-yl)pyrimidine-2,4,5-triamine.
| Compound Name | 4-N-[[6-(chloromethyl)-2-pyridinyl]methyl]-6-(5-methylfuran-2-yl)pyrimidine-2,4,5-triamine |
|---|---|
| PubChem CID | 146475044 |
| Molecular Formula | C16H17ClN6O |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 4-N-[[6-(chloromethyl)-2-pyridinyl]methyl]-6-(5-methylfuran-2-yl)pyrimidine-2,4,5-triamine |
| SMILES | Cc1ccc(-c2nc(N)nc(NCc3cccc(CCl)n3)c2N)o1 |
| InChI | InChI=1S/C16H17ClN6O/c1-9-5-6-12(24-9)14-13(18)15(23-16(19)22-14)20-8-11-4-2-3-10(7-17)21-11/h2-6H,7-8,18H2,1H3,(H3,19,20,22,23) |
| InChIKey | ZOZXLINBSJYBOR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 115.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|