C12H12N4O2 — CID 18507302
2-amino-4-ethoxy-6-(5-methylfuran-2-yl)pyrimidine-5-carbonitrile (PubChem CID 18507302) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is 2-amino-4-ethoxy-6-(5-methylfuran-2-yl)pyrimidine-5-carbonitrile.
| Compound Name | 2-amino-4-ethoxy-6-(5-methylfuran-2-yl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 18507302 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 2-amino-4-ethoxy-6-(5-methylfuran-2-yl)pyrimidine-5-carbonitrile |
| SMILES | CCOc1nc(N)nc(-c2ccc(C)o2)c1C#N |
| InChI | InChI=1S/C12H12N4O2/c1-3-17-11-8(6-13)10(15-12(14)16-11)9-5-4-7(2)18-9/h4-5H,3H2,1-2H3,(H2,14,15,16) |
| InChIKey | SCCPENZIZAILFF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |