C18H14N4O2 — CID 69289830
2-amino-4-(furan-2-yl)-6-(3-phenylprop-2-enoxy)pyrimidine-5-carbonitrile (PubChem CID 69289830) has the molecular formula C18H14N4O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is 2-amino-4-(furan-2-yl)-6-(3-phenylprop-2-enoxy)pyrimidine-5-carbonitrile.
| Compound Name | 2-amino-4-(furan-2-yl)-6-(3-phenylprop-2-enoxy)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 69289830 |
| Molecular Formula | C18H14N4O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 2-amino-4-(furan-2-yl)-6-(3-phenylprop-2-enoxy)pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(OCC=Cc2ccccc2)nc(N)nc1-c1ccco1 |
| InChI | InChI=1S/C18H14N4O2/c19-12-14-16(15-9-5-10-23-15)21-18(20)22-17(14)24-11-4-8-13-6-2-1-3-7-13/h1-10H,11H2,(H2,20,21,22) |
| InChIKey | UFQIWUHUQYFDCC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 97.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |