C14H11ClN4O2 — CID 18507689
5-chloro-4-(furan-2-yl)-6-(pyridin-2-ylmethoxy)pyrimidin-2-amine (PubChem CID 18507689) has the molecular formula C14H11ClN4O2 and a molecular weight of 302.72 g/mol. Its IUPAC name is 5-chloro-4-(furan-2-yl)-6-(pyridin-2-ylmethoxy)pyrimidin-2-amine.
| Compound Name | 5-chloro-4-(furan-2-yl)-6-(pyridin-2-ylmethoxy)pyrimidin-2-amine |
|---|---|
| PubChem CID | 18507689 |
| Molecular Formula | C14H11ClN4O2 |
| Molecular Weight | 302.72 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 5-chloro-4-(furan-2-yl)-6-(pyridin-2-ylmethoxy)pyrimidin-2-amine |
| SMILES | Nc1nc(OCc2ccccn2)c(Cl)c(-c2ccco2)n1 |
| InChI | InChI=1S/C14H11ClN4O2/c15-11-12(10-5-3-7-20-10)18-14(16)19-13(11)21-8-9-4-1-2-6-17-9/h1-7H,8H2,(H2,16,18,19) |
| InChIKey | CSITZLITYIKOCG-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 87.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.72 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |