C18H18N2O3 — CID 42537781
8-(furan-2-yl)-3,3-dimethyl-6-prop-2-enoxy-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile (PubChem CID 42537781) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is 8-(furan-2-yl)-3,3-dimethyl-6-prop-2-enoxy-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile.
| Compound Name | 8-(furan-2-yl)-3,3-dimethyl-6-prop-2-enoxy-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 42537781 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 8-(furan-2-yl)-3,3-dimethyl-6-prop-2-enoxy-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile |
| SMILES | C=CCOc1nc(-c2ccco2)c2c(c1C#N)CC(C)(C)OC2 |
| InChI | InChI=1S/C18H18N2O3/c1-4-7-22-17-13(10-19)12-9-18(2,3)23-11-14(12)16(20-17)15-6-5-8-21-15/h4-6,8H,1,7,9,11H2,2-3H3 |
| InChIKey | QSYWEJLTWRKFTA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|