C16H21N5O — CID 156716151
2-amino-4-(cyclopentylamino)-6-(furan-2-yl)pyrimidine-5-carbonitrile;ethane (PubChem CID 156716151) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is 2-amino-4-(cyclopentylamino)-6-(furan-2-yl)pyrimidine-5-carbonitrile;ethane.
| Compound Name | 2-amino-4-(cyclopentylamino)-6-(furan-2-yl)pyrimidine-5-carbonitrile;ethane |
|---|---|
| PubChem CID | 156716151 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 2-amino-4-(cyclopentylamino)-6-(furan-2-yl)pyrimidine-5-carbonitrile;ethane |
| SMILES | CC.N#Cc1c(NC2CCCC2)nc(N)nc1-c1ccco1 |
| InChI | InChI=1S/C14H15N5O.C2H6/c15-8-10-12(11-6-3-7-20-11)18-14(16)19-13(10)17-9-4-1-2-5-9;1-2/h3,6-7,9H,1-2,4-5H2,(H3,16,17,18,19);1-2H3 |
| InChIKey | HLWXPZNYUFJDIX-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 100.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |