C13H15N5O — CID 80911860
4-hydrazinyl-6-[(E)-3-phenylprop-2-enoxy]pyrimidin-2-amine (PubChem CID 80911860) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is 4-hydrazinyl-6-[(E)-3-phenylprop-2-enoxy]pyrimidin-2-amine.
| Compound Name | 4-hydrazinyl-6-[(E)-3-phenylprop-2-enoxy]pyrimidin-2-amine |
|---|---|
| PubChem CID | 80911860 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 4-hydrazinyl-6-[(E)-3-phenylprop-2-enoxy]pyrimidin-2-amine |
| SMILES | NNc1cc(OC/C=C/c2ccccc2)nc(N)n1 |
| InChI | InChI=1S/C13H15N5O/c14-13-16-11(18-15)9-12(17-13)19-8-4-7-10-5-2-1-3-6-10/h1-7,9H,8,15H2,(H3,14,16,17,18)/b7-4+ |
| InChIKey | AZLORXHAZITDRC-QPJJXVBHSA-N |
| XLogP | 1.44 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|