C16H12BrN5O2 — CID 10156952
2-amino-4-(5-bromofuran-2-yl)-6-[(5-methyl-2-pyridinyl)methoxy]pyrimidine-5-carbonitrile (PubChem CID 10156952) has the molecular formula C16H12BrN5O2 and a molecular weight of 386.21 g/mol. Its IUPAC name is 2-amino-4-(5-bromofuran-2-yl)-6-[(5-methyl-2-pyridinyl)methoxy]pyrimidine-5-carbonitrile.
| Compound Name | 2-amino-4-(5-bromofuran-2-yl)-6-[(5-methyl-2-pyridinyl)methoxy]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 10156952 |
| Molecular Formula | C16H12BrN5O2 |
| Molecular Weight | 386.21 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | 2-amino-4-(5-bromofuran-2-yl)-6-[(5-methyl-2-pyridinyl)methoxy]pyrimidine-5-carbonitrile |
| SMILES | Cc1ccc(COc2nc(N)nc(-c3ccc(Br)o3)c2C#N)nc1 |
| InChI | InChI=1S/C16H12BrN5O2/c1-9-2-3-10(20-7-9)8-23-15-11(6-18)14(21-16(19)22-15)12-4-5-13(17)24-12/h2-5,7H,8H2,1H3,(H2,19,21,22) |
| InChIKey | OUHWRJSFJYVEGA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.21 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |