C13H15N5OS — CID 18507623
2-amino-4-[2-(dimethylamino)ethoxy]-6-thiophen-2-ylpyrimidine-5-carbonitrile (PubChem CID 18507623) has the molecular formula C13H15N5OS and a molecular weight of 289.36 g/mol. Its IUPAC name is 2-amino-4-[2-(dimethylamino)ethoxy]-6-thiophen-2-ylpyrimidine-5-carbonitrile.
| Compound Name | 2-amino-4-[2-(dimethylamino)ethoxy]-6-thiophen-2-ylpyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 18507623 |
| Molecular Formula | C13H15N5OS |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-amino-4-[2-(dimethylamino)ethoxy]-6-thiophen-2-ylpyrimidine-5-carbonitrile |
| SMILES | CN(C)CCOc1nc(N)nc(-c2cccs2)c1C#N |
| InChI | InChI=1S/C13H15N5OS/c1-18(2)5-6-19-12-9(8-14)11(16-13(15)17-12)10-4-3-7-20-10/h3-4,7H,5-6H2,1-2H3,(H2,15,16,17) |
| InChIKey | SWYFMLFWBSDZIK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 88.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |