C8H16ClNO3 — CID 155291136
methyl (2R,6R)-6-ethylmorpholine-2-carboxylate;hydrochloride (PubChem CID 155291136) has the molecular formula C8H16ClNO3 and a molecular weight of 209.67 g/mol. Its IUPAC name is methyl (2R,6R)-6-ethylmorpholine-2-carboxylate;hydrochloride.
| Compound Name | methyl (2R,6R)-6-ethylmorpholine-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 155291136 |
| Molecular Formula | C8H16ClNO3 |
| Molecular Weight | 209.67 g/mol |
| Exact Mass | 209.08 |
| IUPAC Name | methyl (2R,6R)-6-ethylmorpholine-2-carboxylate;hydrochloride |
| SMILES | CC[C@@H]1CNC[C@H](C(=O)OC)O1.Cl |
| InChI | InChI=1S/C8H15NO3.ClH/c1-3-6-4-9-5-7(12-6)8(10)11-2;/h6-7,9H,3-5H2,1-2H3;1H/t6-,7-;/m1./s1 |
| InChIKey | PBGSDQNICRIQCH-ZJLYAJKPSA-N |
| XLogP | 0.35 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.67 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |