C7H9ClN2O3 — CID 155291531
4-chloro-1-(2-methoxyethyl)pyrazole-3-carboxylic acid (PubChem CID 155291531) has the molecular formula C7H9ClN2O3 and a molecular weight of 204.61 g/mol. Its IUPAC name is 4-chloro-1-(2-methoxyethyl)pyrazole-3-carboxylic acid.
| Compound Name | 4-chloro-1-(2-methoxyethyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 155291531 |
| Molecular Formula | C7H9ClN2O3 |
| Molecular Weight | 204.61 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 4-chloro-1-(2-methoxyethyl)pyrazole-3-carboxylic acid |
| SMILES | COCCn1cc(Cl)c(C(=O)O)n1 |
| InChI | InChI=1S/C7H9ClN2O3/c1-13-3-2-10-4-5(8)6(9-10)7(11)12/h4H,2-3H2,1H3,(H,11,12) |
| InChIKey | XEIDBIVBTQXNSI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.61 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |