C11H8Cl2N2O3 — CID 19618765
4-chloro-1-[(2-chlorophenoxy)methyl]pyrazole-3-carboxylic acid (PubChem CID 19618765) has the molecular formula C11H8Cl2N2O3 and a molecular weight of 287.10 g/mol. Its IUPAC name is 4-chloro-1-[(2-chlorophenoxy)methyl]pyrazole-3-carboxylic acid.
| Compound Name | 4-chloro-1-[(2-chlorophenoxy)methyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19618765 |
| Molecular Formula | C11H8Cl2N2O3 |
| Molecular Weight | 287.10 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | 4-chloro-1-[(2-chlorophenoxy)methyl]pyrazole-3-carboxylic acid |
| SMILES | O=C(O)c1nn(COc2ccccc2Cl)cc1Cl |
| InChI | InChI=1S/C11H8Cl2N2O3/c12-7-3-1-2-4-9(7)18-6-15-5-8(13)10(14-15)11(16)17/h1-5H,6H2,(H,16,17) |
| InChIKey | RUGFYICDZPHYEG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.10 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |