C19H24NOPS — CID 155297509
2-butan-2-yl-5-oxo-10-propan-2-ylbenzo[b][1,4]benzothiaphosphinin-1-amine (PubChem CID 155297509) has the molecular formula C19H24NOPS and a molecular weight of 345.45 g/mol. Its IUPAC name is 2-butan-2-yl-5-oxo-10-propan-2-ylbenzo[b][1,4]benzothiaphosphinin-1-amine.
| Compound Name | 2-butan-2-yl-5-oxo-10-propan-2-ylbenzo[b][1,4]benzothiaphosphinin-1-amine |
|---|---|
| PubChem CID | 155297509 |
| Molecular Formula | C19H24NOPS |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-butan-2-yl-5-oxo-10-propan-2-ylbenzo[b][1,4]benzothiaphosphinin-1-amine |
| SMILES | CCC(C)c1ccc2c(c1N)P(C(C)C)c1ccccc1S2=O |
| InChI | InChI=1S/C19H24NOPS/c1-5-13(4)14-10-11-17-19(18(14)20)22(12(2)3)15-8-6-7-9-16(15)23(17)21/h6-13H,5,20H2,1-4H3 |
| InChIKey | GBEQPLZNUIOMNQ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|