C16H19N3O2 — CID 155298542
N-(3-aminocyclohexyl)-2-phenyl-1,3-oxazole-4-carboxamide (PubChem CID 155298542) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is N-(3-aminocyclohexyl)-2-phenyl-1,3-oxazole-4-carboxamide.
| Compound Name | N-(3-aminocyclohexyl)-2-phenyl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 155298542 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-(3-aminocyclohexyl)-2-phenyl-1,3-oxazole-4-carboxamide |
| SMILES | NC1CCCC(NC(=O)c2coc(-c3ccccc3)n2)C1 |
| InChI | InChI=1S/C16H19N3O2/c17-12-7-4-8-13(9-12)18-15(20)14-10-21-16(19-14)11-5-2-1-3-6-11/h1-3,5-6,10,12-13H,4,7-9,17H2,(H,18,20) |
| InChIKey | DSHVCGYPSSBWGB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |