C42H32N2S — CID 155299378
(3Z,5E)-4-(7,7-dimethylfluoreno[2,3-b][1]benzothiol-2-yl)-5-(3-methyl-3,4-dihydrocarbazol-9-yl)octa-3,5-dien-7-ynenitrile (PubChem CID 155299378) has the molecular formula C42H32N2S and a molecular weight of 596.80 g/mol. Its IUPAC name is (3Z,5E)-4-(7,7-dimethylfluoreno[2,3-b][1]benzothiol-2-yl)-5-(3-methyl-3,4-dihydrocarbazol-9-yl)octa-3,5-dien-7-ynenitrile.
| Compound Name | (3Z,5E)-4-(7,7-dimethylfluoreno[2,3-b][1]benzothiol-2-yl)-5-(3-methyl-3,4-dihydrocarbazol-9-yl)octa-3,5-dien-7-ynenitrile |
|---|---|
| PubChem CID | 155299378 |
| Molecular Formula | C42H32N2S |
| Molecular Weight | 596.80 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | (3Z,5E)-4-(7,7-dimethylfluoreno[2,3-b][1]benzothiol-2-yl)-5-(3-methyl-3,4-dihydrocarbazol-9-yl)octa-3,5-dien-7-ynenitrile |
| SMILES | C#C/C=C(C(=C/CC#N)\c1ccc2sc3cc4c(cc3c2c1)-c1ccccc1C4(C)C)/n1c2c(c3ccccc31)CC(C)C=C2 |
| InChI | InChI=1S/C42H32N2S/c1-5-11-37(44-38-16-9-7-13-30(38)32-22-26(2)17-19-39(32)44)28(14-10-21-43)27-18-20-40-33(23-27)34-24-31-29-12-6-8-15-35(29)42(3,4)36(31)25-41(34)45-40/h1,6-9,11-20,23-26H,10,22H2,2-4H3/b28-14-,37-11+ |
| InChIKey | KCQQZGASOSRVLA-PEDBPJMASA-N |
| XLogP | 10.99 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.80 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|