C51H69FO5S2 — CID 155300400
3-[2-[2,2-bis(sulfanylmethyl)butoxy]-5-[3-ethyl-4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2-methylprop-2-enoate (PubChem CID 155300400) has the molecular formula C51H69FO5S2 and a molecular weight of 845.24 g/mol. Its IUPAC name is 3-[2-[2,2-bis(sulfanylmethyl)butoxy]-5-[3-ethyl-4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-[2,2-bis(sulfanylmethyl)butoxy]-5-[3-ethyl-4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155300400 |
| Molecular Formula | C51H69FO5S2 |
| Molecular Weight | 845.24 g/mol |
| Exact Mass | 844.46 |
| IUPAC Name | 3-[2-[2,2-bis(sulfanylmethyl)butoxy]-5-[3-ethyl-4-[2-fluoro-4-(4-pentylcyclohexyl)phenyl]phenyl]-3-[3-(2-methylprop-2-enoyloxy)propyl]phenyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCc1cc(-c2ccc(-c3ccc(C4CCC(CCCCC)CC4)cc3F)c(CC)c2)cc(CCCOC(=O)C(=C)C)c1OCC(CC)(CS)CS |
| InChI | InChI=1S/C51H69FO5S2/c1-8-11-12-15-37-18-20-39(21-19-37)41-23-25-46(47(52)31-41)45-24-22-40(28-38(45)9-2)44-29-42(16-13-26-55-49(53)35(4)5)48(57-32-51(10-3,33-58)34-59)43(30-44)17-14-27-56-50(54)36(6)7/h22-25,28-31,37,39,58-59H,4,6,8-21,26-27,32-34H2,1-3,5,7H3 |
| InChIKey | WVHAEAJGAWTKDQ-UHFFFAOYSA-N |
| XLogP | 13.31 |
| TPSA | 61.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.24 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|