About [2-[(4-benzoylbenzoyl)oxymethyl]-2-methylpentyl] 4-benzoylbenzoate
[2-[(4-benzoylbenzoyl)oxymethyl]-2-methylpentyl] 4-benzoylbenzoate (PubChem CID 155301055) has the molecular formula C35H32O6
and a molecular weight of 548.64 g/mol. Its IUPAC name is [2-[(4-benzoylbenzoyl)oxymethyl]-2-methylpentyl] 4-benzoylbenzoate.
Molecular Properties
| Compound Name | [2-[(4-benzoylbenzoyl)oxymethyl]-2-methylpentyl] 4-benzoylbenzoate |
| PubChem CID | 155301055 |
| Molecular Formula | C35H32O6 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | [2-[(4-benzoylbenzoyl)oxymethyl]-2-methylpentyl] 4-benzoylbenzoate |
| SMILES | CCCC(C)(COC(=O)c1ccc(C(=O)c2ccccc2)cc1)COC(=O)c1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H32O6/c1-3-22-35(2,23-40-33(38)29-18-14-27(15-19-29)31(36)25-10-6-4-7-11-25)24-41-34(39)30-20-16-28(17-21-30)32(37)26-12-8-5-9-13-26/h4-21H,3,22-24H2,1-2H3 |
| InChIKey | GTCIZWWJVLFBMN-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(4-benzoylbenzoyl)oxymethyl]-2-methylpentyl] 4-benzoylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-benzoylbenzoyl)oxymethyl]-2-methylpentyl] 4-benzoylbenzoate?
The IUPAC name of [2-[(4-benzoylbenzoyl)oxymethyl]-2-methylpentyl] 4-benzoylbenzoate (CID 155301055) is [2-[(4-benzoylbenzoyl)oxymethyl]-2-methylpentyl] 4-benzoylbenzoate.
What is the SMILES notation for [2-[(4-benzoylbenzoyl)oxymethyl]-2-methylpentyl] 4-benzoylbenzoate?
The canonical SMILES for [2-[(4-benzoylbenzoyl)oxymethyl]-2-methylpentyl] 4-benzoylbenzoate is CCCC(C)(COC(=O)c1ccc(C(=O)c2ccccc2)cc1)COC(=O)c1ccc(C(=O)c2ccccc2)cc1.
What is the InChIKey of [2-[(4-benzoylbenzoyl)oxymethyl]-2-methylpentyl] 4-benzoylbenzoate?
The InChIKey is GTCIZWWJVLFBMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H32O6/c1-3-22-35(2,23-40-33(38)29-18-14-27(15-19-29)31(36)25-10-6-4-7-11-25)24-41-34(39)30-20-16-28(17-21-30)32(37)26-12-8-5-9-13-26/h4-21H,3,22-24H2,1-2H3.
What are the key properties of [2-[(4-benzoylbenzoyl)oxymethyl]-2-methylpentyl] 4-benzoylbenzoate?
[2-[(4-benzoylbenzoyl)oxymethyl]-2-methylpentyl] 4-benzoylbenzoate has a molecular weight of 548.64 g/mol, XLogP of 6.97, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-benzoylbenzoyl)oxymethyl]-2-methylpentyl] 4-benzoylbenzoate is sourced from PubChem (CID 155301055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).