C35H32NO4P — CID 15530202
benzyl (2S)-3,7-dioxo-2-propan-2-yl-4-(triphenyl-lambda5-phosphanylidene)-2H-azepine-1-carboxylate (PubChem CID 15530202) has the molecular formula C35H32NO4P and a molecular weight of 561.62 g/mol. Its IUPAC name is benzyl (2S)-3,7-dioxo-2-propan-2-yl-4-(triphenyl-lambda5-phosphanylidene)-2H-azepine-1-carboxylate.
| Compound Name | benzyl (2S)-3,7-dioxo-2-propan-2-yl-4-(triphenyl-lambda5-phosphanylidene)-2H-azepine-1-carboxylate |
|---|---|
| PubChem CID | 15530202 |
| Molecular Formula | C35H32NO4P |
| Molecular Weight | 561.62 g/mol |
| Exact Mass | 561.21 |
| IUPAC Name | benzyl (2S)-3,7-dioxo-2-propan-2-yl-4-(triphenyl-lambda5-phosphanylidene)-2H-azepine-1-carboxylate |
| SMILES | CC(C)[C@H]1C(=O)C(=P(c2ccccc2)(c2ccccc2)c2ccccc2)C=CC(=O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H32NO4P/c1-26(2)33-34(38)31(23-24-32(37)36(33)35(39)40-25-27-15-7-3-8-16-27)41(28-17-9-4-10-18-28,29-19-11-5-12-20-29)30-21-13-6-14-22-30/h3-24,26,33H,25H2,1-2H3/t33-/m0/s1 |
| InChIKey | IBHUUKRIBJSKQR-XIFFEERXSA-N |
| XLogP | 5.48 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.62 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|