C19H22ClN3O5 — CID 155303020
2-(3-chlorophenoxy)-N-[(2S)-2-hydroxy-4-[(2-pyridin-2-yloxyacetyl)amino]butyl]acetamide (PubChem CID 155303020) has the molecular formula C19H22ClN3O5 and a molecular weight of 407.85 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)-N-[(2S)-2-hydroxy-4-[(2-pyridin-2-yloxyacetyl)amino]butyl]acetamide.
| Compound Name | 2-(3-chlorophenoxy)-N-[(2S)-2-hydroxy-4-[(2-pyridin-2-yloxyacetyl)amino]butyl]acetamide |
|---|---|
| PubChem CID | 155303020 |
| Molecular Formula | C19H22ClN3O5 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 2-(3-chlorophenoxy)-N-[(2S)-2-hydroxy-4-[(2-pyridin-2-yloxyacetyl)amino]butyl]acetamide |
| SMILES | O=C(COc1cccc(Cl)c1)NC[C@@H](O)CCNC(=O)COc1ccccn1 |
| InChI | InChI=1S/C19H22ClN3O5/c20-14-4-3-5-16(10-14)27-12-18(26)23-11-15(24)7-9-21-17(25)13-28-19-6-1-2-8-22-19/h1-6,8,10,15,24H,7,9,11-13H2,(H,21,25)(H,23,26)/t15-/m0/s1 |
| InChIKey | QMEQVSYHGVWLHF-HNNXBMFYSA-N |
| XLogP | 1.18 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |