C14H13N5O3 — CID 155304009
3-methyl-1-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-5-oxo-4H-pyrazole-4-carboxamide (PubChem CID 155304009) has the molecular formula C14H13N5O3 and a molecular weight of 299.29 g/mol. Its IUPAC name is 3-methyl-1-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-5-oxo-4H-pyrazole-4-carboxamide.
| Compound Name | 3-methyl-1-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-5-oxo-4H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155304009 |
| Molecular Formula | C14H13N5O3 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 3-methyl-1-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-5-oxo-4H-pyrazole-4-carboxamide |
| SMILES | CC1=NN(c2cccc(-c3noc(C)n3)c2)C(=O)C1C(N)=O |
| InChI | InChI=1S/C14H13N5O3/c1-7-11(12(15)20)14(21)19(17-7)10-5-3-4-9(6-10)13-16-8(2)22-18-13/h3-6,11H,1-2H3,(H2,15,20) |
| InChIKey | WGUJTDLJLSRMNG-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|