C20H21NO4 — CID 15530514
methyl 2-[(1R,2S,9S,10S,11S,12R,16S)-14-methyl-13,15-dioxo-14-azapentacyclo[9.5.1.02,10.03,8.012,16]heptadeca-3,5,7-trien-9-yl]acetate (PubChem CID 15530514) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is methyl 2-[(1R,2S,9S,10S,11S,12R,16S)-14-methyl-13,15-dioxo-14-azapentacyclo[9.5.1.02,10.03,8.012,16]heptadeca-3,5,7-trien-9-yl]acetate.
| Compound Name | methyl 2-[(1R,2S,9S,10S,11S,12R,16S)-14-methyl-13,15-dioxo-14-azapentacyclo[9.5.1.02,10.03,8.012,16]heptadeca-3,5,7-trien-9-yl]acetate |
|---|---|
| PubChem CID | 15530514 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | methyl 2-[(1R,2S,9S,10S,11S,12R,16S)-14-methyl-13,15-dioxo-14-azapentacyclo[9.5.1.02,10.03,8.012,16]heptadeca-3,5,7-trien-9-yl]acetate |
| SMILES | COC(=O)C[C@@H]1c2ccccc2[C@H]2[C@H]3C[C@H]([C@H]4C(=O)N(C)C(=O)[C@@H]34)[C@H]21 |
| InChI | InChI=1S/C20H21NO4/c1-21-19(23)17-12-7-13(18(17)20(21)24)16-11(8-14(22)25-2)9-5-3-4-6-10(9)15(12)16/h3-6,11-13,15-18H,7-8H2,1-2H3/t11-,12-,13+,15+,16-,17+,18-/m1/s1 |
| InChIKey | ODNWAXQHCBJYHZ-IVXOXBRRSA-N |
| XLogP | 1.93 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|