C19H22N2O6 — CID 50948533
methyl (1S,3R,3aS,6aR)-3-(2-methoxy-2-oxoethyl)-5-methyl-1-(2-methylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 50948533) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is methyl (1S,3R,3aS,6aR)-3-(2-methoxy-2-oxoethyl)-5-methyl-1-(2-methylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1S,3R,3aS,6aR)-3-(2-methoxy-2-oxoethyl)-5-methyl-1-(2-methylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 50948533 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | methyl (1S,3R,3aS,6aR)-3-(2-methoxy-2-oxoethyl)-5-methyl-1-(2-methylphenyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | COC(=O)C[C@@]1(C(=O)OC)N[C@H](c2ccccc2C)[C@@H]2C(=O)N(C)C(=O)[C@@H]21 |
| InChI | InChI=1S/C19H22N2O6/c1-10-7-5-6-8-11(10)15-13-14(17(24)21(2)16(13)23)19(20-15,18(25)27-4)9-12(22)26-3/h5-8,13-15,20H,9H2,1-4H3/t13-,14-,15-,19-/m1/s1 |
| InChIKey | UDTXOKJLCPAEEL-DEXNDLTESA-N |
| XLogP | 0.35 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|