C26H30N2O5S — CID 92655887
methyl (1S,3R,3aR,6aS)-5-(4-ethoxyphenyl)-1-(2-methylphenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 92655887) has the molecular formula C26H30N2O5S and a molecular weight of 482.60 g/mol. Its IUPAC name is methyl (1S,3R,3aR,6aS)-5-(4-ethoxyphenyl)-1-(2-methylphenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1S,3R,3aR,6aS)-5-(4-ethoxyphenyl)-1-(2-methylphenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 92655887 |
| Molecular Formula | C26H30N2O5S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | methyl (1S,3R,3aR,6aS)-5-(4-ethoxyphenyl)-1-(2-methylphenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCOc1ccc(N2C(=O)[C@@H]3[C@@H](c4ccccc4C)N[C@@](CCSC)(C(=O)OC)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C26H30N2O5S/c1-5-33-18-12-10-17(11-13-18)28-23(29)20-21(24(28)30)26(14-15-34-4,25(31)32-3)27-22(20)19-9-7-6-8-16(19)2/h6-13,20-22,27H,5,14-15H2,1-4H3/t20-,21-,22+,26+/m0/s1 |
| InChIKey | IBZBIEOVNWOVDH-BTKWVRSESA-N |
| XLogP | 3.51 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|