C25H27FN2O5S — CID 100882412
methyl (1R,3S,3aR,6aS)-5-(4-ethoxyphenyl)-1-(2-fluorophenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate (PubChem CID 100882412) has the molecular formula C25H27FN2O5S and a molecular weight of 486.57 g/mol. Its IUPAC name is methyl (1R,3S,3aR,6aS)-5-(4-ethoxyphenyl)-1-(2-fluorophenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate.
| Compound Name | methyl (1R,3S,3aR,6aS)-5-(4-ethoxyphenyl)-1-(2-fluorophenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 100882412 |
| Molecular Formula | C25H27FN2O5S |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | methyl (1R,3S,3aR,6aS)-5-(4-ethoxyphenyl)-1-(2-fluorophenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylate |
| SMILES | CCOc1ccc(N2C(=O)[C@H]3[C@@H](C2=O)[C@@](CCSC)(C(=O)OC)N[C@H]3c2ccccc2F)cc1 |
| InChI | InChI=1S/C25H27FN2O5S/c1-4-33-16-11-9-15(10-12-16)28-22(29)19-20(23(28)30)25(13-14-34-3,24(31)32-2)27-21(19)17-7-5-6-8-18(17)26/h5-12,19-21,27H,4,13-14H2,1-3H3/t19-,20-,21-,25-/m0/s1 |
| InChIKey | NZMSDFCXJRXTFS-UKDJSQQHSA-N |
| XLogP | 3.34 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|