C22H21BrN2O5S — CID 5038098
5-(4-bromophenyl)-1-(2-hydroxyphenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid (PubChem CID 5038098) has the molecular formula C22H21BrN2O5S and a molecular weight of 505.39 g/mol. Its IUPAC name is 5-(4-bromophenyl)-1-(2-hydroxyphenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid.
| Compound Name | 5-(4-bromophenyl)-1-(2-hydroxyphenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 5038098 |
| Molecular Formula | C22H21BrN2O5S |
| Molecular Weight | 505.39 g/mol |
| Exact Mass | 504.04 |
| IUPAC Name | 5-(4-bromophenyl)-1-(2-hydroxyphenyl)-3-(2-methylsulfanylethyl)-4,6-dioxo-1,2,3a,6a-tetrahydropyrrolo[3,4-c]pyrrole-3-carboxylic acid |
| SMILES | CSCCC1(C(=O)O)NC(c2ccccc2O)C2C(=O)N(c3ccc(Br)cc3)C(=O)C21 |
| InChI | InChI=1S/C22H21BrN2O5S/c1-31-11-10-22(21(29)30)17-16(18(24-22)14-4-2-3-5-15(14)26)19(27)25(20(17)28)13-8-6-12(23)7-9-13/h2-9,16-18,24,26H,10-11H2,1H3,(H,29,30) |
| InChIKey | GQPHXLZRRROWND-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.39 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|