C62H47N5 — CID 155306728
2-[3-[3-(2,6-dimethyl-3-pyridinyl)-5-[5-methylidene-2,7-bis(4-phenylphenyl)-4,6-dihydro-1,3-diazepin-4-yl]phenyl]phenyl]-3-phenylimidazo[1,2-a]pyridine (PubChem CID 155306728) has the molecular formula C62H47N5 and a molecular weight of 862.09 g/mol. Its IUPAC name is 2-[3-[3-(2,6-dimethyl-3-pyridinyl)-5-[5-methylidene-2,7-bis(4-phenylphenyl)-4,6-dihydro-1,3-diazepin-4-yl]phenyl]phenyl]-3-phenylimidazo[1,2-a]pyridine.
| Compound Name | 2-[3-[3-(2,6-dimethyl-3-pyridinyl)-5-[5-methylidene-2,7-bis(4-phenylphenyl)-4,6-dihydro-1,3-diazepin-4-yl]phenyl]phenyl]-3-phenylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 155306728 |
| Molecular Formula | C62H47N5 |
| Molecular Weight | 862.09 g/mol |
| Exact Mass | 861.38 |
| IUPAC Name | 2-[3-[3-(2,6-dimethyl-3-pyridinyl)-5-[5-methylidene-2,7-bis(4-phenylphenyl)-4,6-dihydro-1,3-diazepin-4-yl]phenyl]phenyl]-3-phenylimidazo[1,2-a]pyridine |
| SMILES | C=C1CC(c2ccc(-c3ccccc3)cc2)=NC(c2ccc(-c3ccccc3)cc2)=NC1c1cc(-c2cccc(-c3nc4ccccn4c3-c3ccccc3)c2)cc(-c2ccc(C)nc2C)c1 |
| InChI | InChI=1S/C62H47N5/c1-41-36-57(48-30-26-46(27-31-48)44-16-7-4-8-17-44)64-62(50-32-28-47(29-33-50)45-18-9-5-10-19-45)66-59(41)55-39-53(38-54(40-55)56-34-25-42(2)63-43(56)3)51-22-15-23-52(37-51)60-61(49-20-11-6-12-21-49)67-35-14-13-24-58(67)65-60/h4-35,37-40,59H,1,36H2,2-3H3 |
| InChIKey | PODRTDNHBKDZBE-UHFFFAOYSA-N |
| XLogP | 15.29 |
| TPSA | 54.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.09 |
| LogP ≤ 5 | 15.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|