C35H38FNO5S — CID 155307938
4-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-[(2-methylphenyl)methyl]-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-4-methylcyclohexane-1-carboxylic acid (PubChem CID 155307938) has the molecular formula C35H38FNO5S and a molecular weight of 603.76 g/mol. Its IUPAC name is 4-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-[(2-methylphenyl)methyl]-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-4-methylcyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-[(2-methylphenyl)methyl]-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-4-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 155307938 |
| Molecular Formula | C35H38FNO5S |
| Molecular Weight | 603.76 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | 4-[(3aR,9bR)-9b-(4-fluorophenyl)sulfonyl-7-[(2-methylphenyl)methyl]-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-4-methylcyclohexane-1-carboxylic acid |
| SMILES | Cc1ccccc1Cc1ccc2c(c1)CC[C@H]1N(C(=O)C3(C)CCC(C(=O)O)CC3)CC[C@@]21S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C35H38FNO5S/c1-23-5-3-4-6-26(23)21-24-7-13-30-27(22-24)8-14-31-35(30,43(41,42)29-11-9-28(36)10-12-29)19-20-37(31)33(40)34(2)17-15-25(16-18-34)32(38)39/h3-7,9-13,22,25,31H,8,14-21H2,1-2H3,(H,38,39)/t25?,31-,34?,35-/m1/s1 |
| InChIKey | QCNABGBCTMJWEJ-DXOKBMBUSA-N |
| XLogP | 6.22 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.76 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |