C32H35NO6S2 — CID 155307829
[(3aR,9bR)-9b-(benzenesulfonyl)-7-[(2-methylphenyl)methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothian-4-yl)methanone (PubChem CID 155307829) has the molecular formula C32H35NO6S2 and a molecular weight of 593.77 g/mol. Its IUPAC name is [(3aR,9bR)-9b-(benzenesulfonyl)-7-[(2-methylphenyl)methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothian-4-yl)methanone.
| Compound Name | [(3aR,9bR)-9b-(benzenesulfonyl)-7-[(2-methylphenyl)methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothian-4-yl)methanone |
|---|---|
| PubChem CID | 155307829 |
| Molecular Formula | C32H35NO6S2 |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | [(3aR,9bR)-9b-(benzenesulfonyl)-7-[(2-methylphenyl)methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothian-4-yl)methanone |
| SMILES | Cc1ccccc1COc1ccc2c(c1)CC[C@H]1N(C(=O)C3CCS(=O)(=O)CC3)CC[C@@]21S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H35NO6S2/c1-23-7-5-6-8-26(23)22-39-27-12-13-29-25(21-27)11-14-30-32(29,41(37,38)28-9-3-2-4-10-28)17-18-33(30)31(34)24-15-19-40(35,36)20-16-24/h2-10,12-13,21,24,30H,11,14-20,22H2,1H3/t30-,32-/m1/s1 |
| InChIKey | GMRKYTRZNJAAEL-XLJNKUFUSA-N |
| XLogP | 4.62 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |