C34H34Cl2N2O5S — CID 155287515
1-[6-[(3aR,9bR)-9b-(benzenesulfonyl)-7-[(2,6-dichlorophenyl)methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-2-azaspiro[3.3]heptan-2-yl]ethanone (PubChem CID 155287515) has the molecular formula C34H34Cl2N2O5S and a molecular weight of 653.63 g/mol. Its IUPAC name is 1-[6-[(3aR,9bR)-9b-(benzenesulfonyl)-7-[(2,6-dichlorophenyl)methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-2-azaspiro[3.3]heptan-2-yl]ethanone.
| Compound Name | 1-[6-[(3aR,9bR)-9b-(benzenesulfonyl)-7-[(2,6-dichlorophenyl)methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-2-azaspiro[3.3]heptan-2-yl]ethanone |
|---|---|
| PubChem CID | 155287515 |
| Molecular Formula | C34H34Cl2N2O5S |
| Molecular Weight | 653.63 g/mol |
| Exact Mass | 652.16 |
| IUPAC Name | 1-[6-[(3aR,9bR)-9b-(benzenesulfonyl)-7-[(2,6-dichlorophenyl)methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]-2-azaspiro[3.3]heptan-2-yl]ethanone |
| SMILES | CC(=O)N1CC2(CC(C(=O)N3CC[C@@]4(S(=O)(=O)c5ccccc5)c5ccc(OCc6c(Cl)cccc6Cl)cc5CC[C@@H]34)C2)C1 |
| InChI | InChI=1S/C34H34Cl2N2O5S/c1-22(39)37-20-33(21-37)17-24(18-33)32(40)38-15-14-34(44(41,42)26-6-3-2-4-7-26)28-12-11-25(16-23(28)10-13-31(34)38)43-19-27-29(35)8-5-9-30(27)36/h2-9,11-12,16,24,31H,10,13-15,17-21H2,1H3/t31-,34-/m1/s1 |
| InChIKey | PCCLVROOFLCHFV-QIKUIUABSA-N |
| XLogP | 6.05 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.63 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |