C30H28Cl2FNO6S2 — CID 155307790
[(3aR,9bR)-7-[(2,6-dichlorophenyl)methoxy]-9b-(4-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothiolan-3-yl)methanone (PubChem CID 155307790) has the molecular formula C30H28Cl2FNO6S2 and a molecular weight of 652.59 g/mol. Its IUPAC name is [(3aR,9bR)-7-[(2,6-dichlorophenyl)methoxy]-9b-(4-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothiolan-3-yl)methanone.
| Compound Name | [(3aR,9bR)-7-[(2,6-dichlorophenyl)methoxy]-9b-(4-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothiolan-3-yl)methanone |
|---|---|
| PubChem CID | 155307790 |
| Molecular Formula | C30H28Cl2FNO6S2 |
| Molecular Weight | 652.59 g/mol |
| Exact Mass | 651.07 |
| IUPAC Name | [(3aR,9bR)-7-[(2,6-dichlorophenyl)methoxy]-9b-(4-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-(1,1-dioxothiolan-3-yl)methanone |
| SMILES | O=C(C1CCS(=O)(=O)C1)N1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(OCc4c(Cl)cccc4Cl)cc3CC[C@@H]12 |
| InChI | InChI=1S/C30H28Cl2FNO6S2/c31-26-2-1-3-27(32)24(26)17-40-22-7-10-25-19(16-22)4-11-28-30(25,42(38,39)23-8-5-21(33)6-9-23)13-14-34(28)29(35)20-12-15-41(36,37)18-20/h1-3,5-10,16,20,28H,4,11-15,17-18H2/t20?,28-,30-/m1/s1 |
| InChIKey | VRGALGQLYAJPKE-HZFOSRTRSA-N |
| XLogP | 5.36 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |