C32H33Cl2N3O5S — CID 169054091
4-[(3aR,9bR)-9b-(benzenesulfonyl)-7-[(2,6-dichlorophenyl)methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]piperidine-1-carboxamide (PubChem CID 169054091) has the molecular formula C32H33Cl2N3O5S and a molecular weight of 642.61 g/mol. Its IUPAC name is 4-[(3aR,9bR)-9b-(benzenesulfonyl)-7-[(2,6-dichlorophenyl)methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]piperidine-1-carboxamide.
| Compound Name | 4-[(3aR,9bR)-9b-(benzenesulfonyl)-7-[(2,6-dichlorophenyl)methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 169054091 |
| Molecular Formula | C32H33Cl2N3O5S |
| Molecular Weight | 642.61 g/mol |
| Exact Mass | 641.15 |
| IUPAC Name | 4-[(3aR,9bR)-9b-(benzenesulfonyl)-7-[(2,6-dichlorophenyl)methoxy]-2,3a,4,5-tetrahydro-1H-benzo[e]indole-3-carbonyl]piperidine-1-carboxamide |
| SMILES | NC(=O)N1CCC(C(=O)N2CC[C@@]3(S(=O)(=O)c4ccccc4)c4ccc(OCc5c(Cl)cccc5Cl)cc4CC[C@@H]23)CC1 |
| InChI | InChI=1S/C32H33Cl2N3O5S/c33-27-7-4-8-28(34)25(27)20-42-23-10-11-26-22(19-23)9-12-29-32(26,43(40,41)24-5-2-1-3-6-24)15-18-37(29)30(38)21-13-16-36(17-14-21)31(35)39/h1-8,10-11,19,21,29H,9,12-18,20H2,(H2,35,39)/t29-,32-/m1/s1 |
| InChIKey | YHANQGOSKLAXDU-QLWXXVCSSA-N |
| XLogP | 5.58 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.61 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |