C31H31Cl2FN2O6S2 — CID 169054119
1-[(3aR,9bR)-7-[(2,6-dichlorophenyl)methoxy]-9b-(4-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone (PubChem CID 169054119) has the molecular formula C31H31Cl2FN2O6S2 and a molecular weight of 681.63 g/mol. Its IUPAC name is 1-[(3aR,9bR)-7-[(2,6-dichlorophenyl)methoxy]-9b-(4-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone.
| Compound Name | 1-[(3aR,9bR)-7-[(2,6-dichlorophenyl)methoxy]-9b-(4-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone |
|---|---|
| PubChem CID | 169054119 |
| Molecular Formula | C31H31Cl2FN2O6S2 |
| Molecular Weight | 681.63 g/mol |
| Exact Mass | 680.10 |
| IUPAC Name | 1-[(3aR,9bR)-7-[(2,6-dichlorophenyl)methoxy]-9b-(4-fluorophenyl)sulfonyl-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone |
| SMILES | O=C(CN1CCS(=O)(=O)CC1)N1CC[C@@]2(S(=O)(=O)c3ccc(F)cc3)c3ccc(OCc4c(Cl)cccc4Cl)cc3CC[C@@H]12 |
| InChI | InChI=1S/C31H31Cl2FN2O6S2/c32-27-2-1-3-28(33)25(27)20-42-23-7-10-26-21(18-23)4-11-29-31(26,44(40,41)24-8-5-22(34)6-9-24)12-13-36(29)30(37)19-35-14-16-43(38,39)17-15-35/h1-3,5-10,18,29H,4,11-17,19-20H2/t29-,31-/m1/s1 |
| InChIKey | LXIJWTIPYAHCBG-BVRKHOPBSA-N |
| XLogP | 4.66 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |