C27H27F7N2O5S2 — CID 122679208
1-[(3aS,9bS)-9b-(benzenesulfonyl)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone (PubChem CID 122679208) has the molecular formula C27H27F7N2O5S2 and a molecular weight of 656.64 g/mol. Its IUPAC name is 1-[(3aS,9bS)-9b-(benzenesulfonyl)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone.
| Compound Name | 1-[(3aS,9bS)-9b-(benzenesulfonyl)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone |
|---|---|
| PubChem CID | 122679208 |
| Molecular Formula | C27H27F7N2O5S2 |
| Molecular Weight | 656.64 g/mol |
| Exact Mass | 656.12 |
| IUPAC Name | 1-[(3aS,9bS)-9b-(benzenesulfonyl)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3a,4,5-tetrahydro-1H-benzo[e]indol-3-yl]-2-(1,1-dioxo-1,4-thiazinan-4-yl)ethanone |
| SMILES | O=C(CN1CCS(=O)(=O)CC1)N1CC[C@]2(S(=O)(=O)c3ccccc3)c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@H]12 |
| InChI | InChI=1S/C27H27F7N2O5S2/c28-25(26(29,30)31,27(32,33)34)19-7-8-21-18(16-19)6-9-22-24(21,43(40,41)20-4-2-1-3-5-20)10-11-36(22)23(37)17-35-12-14-42(38,39)15-13-35/h1-5,7-8,16,22H,6,9-15,17H2/t22-,24-/m0/s1 |
| InChIKey | DOMKFIOVSXNRFY-UPVQGACJSA-N |
| XLogP | 3.92 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.64 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |